| MolName | 2-[[4-[(Z)-(4-chlorophenyl)methylideneamino]-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-1-[4-(difluoromethoxy)phenyl]ethanone |
| MolecularFormula | C23H16N5O2ClF2S |
| Smiles | O=C(CSc1nnc(-c2cnccc2)n1/N=C\c(cc1)ccc1Cl)c(cc1)ccc1OC(F)F |
| InChI | InChI=1S/C23H16ClF2N5O2S/c24-18-7-3-15(4-8-18)12-28-31-21(17-2-1-11-27-13-17)29-30-23(31)34-14-20(32)16-5-9-19(10-6-16)33-22(25)26/h1-13,22H,14H2 |
| InChIK | XASKVOFETUNBMG-UHFFFAOYSA-N |
| TotalMolweight | 499.928 |
| Molweight | 499.928 |
| MonoisotopicMass | 499.068128 |
| CLogP | 4.4157 |
| CLogS | -9.183 |
| H Acceptors | 7 |
| TotalSurfaceArea | 362.4 |
| Relative PSA | 0.25337 |
| PolarSurfaceArea | 107.56 |
| Druglikeness | 1.2417 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.55882 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 4 |
| Symmetricatoms | 5 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - 2-[[4-[(Z)-(4-chlorophenyl)methylideneamino]-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-1-[4-(difluoromethoxy)phenyl]ethanone | 2 - 2-[[4-[(Z)-(4-chlorophenyl)methylideneamino]-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-1-[4-(difluoromethoxy)phenyl]ethanone