| MolName | N-(2-fluorophenyl)-N'-[(Z)-[2-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]methylideneamino]oxamide |
| MolecularFormula | C21H21N4O4F |
| Smiles | O=C(COc1c(/C=N\NC(C(Nc(cccc2)c2F)=O)=O)cccc1)N1CCCC1 |
| InChI | InChI=1S/C21H21FN4O4/c22-16-8-2-3-9-17(16)24-20(28)21(29)25-23-13-15-7-1-4-10-18(15)30-14-19(27)26-11-5-6-12-26/h1-4,7-10,13H,5-6,11-12,14H2,(H,24,28)(H,25,29) |
| InChIK | XASZQGNYHHWPOW-UHFFFAOYSA-N |
| TotalMolweight | 412.42 |
| Molweight | 412.42 |
| MonoisotopicMass | 412.154684 |
| CLogP | 2.3159 |
| CLogS | -3.948 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 315.9 |
| Relative PSA | 0.27572 |
| PolarSurfaceArea | 100.1 |
| Druglikeness | 4.3537 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| Symmetricatoms | 2 |
| Amides | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-(2-fluorophenyl)-N'-[(Z)-[2-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]methylideneamino]oxamide | 2 - N-(2-fluorophenyl)-N'-[(Z)-[2-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]methylideneamino]oxamide