| MolName | 4-nitro-2-[(Z)-[[2-(1,2,4-triazol-1-yl)acetyl]hydrazinylidene]methyl]phenolate |
| MolecularFormula | C11H9N6O4 |
| Smiles | [O-]c(cc1)c(/C=N\NC(Cn2ncnc2)=O)cc1[N+]([O-])=O |
| InChI | InChI=1S/C11H10N6O4/c18-10-2-1-9(17(20)21)3-8(10)4-13-15-11(19)5-16-7-12-6-14-16/h1-4,6-7,18H,5H2,(H,15,19)/p-1 |
| InChIK | XATIRSXRTZVQLA-UHFFFAOYSA-M |
| TotalMolweight | 289.23 |
| Molweight | 289.23 |
| MonoisotopicMass | 289.068529 |
| CLogP | -2.2105 |
| CLogS | -2.496 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 218.67 |
| Relative PSA | 0.50085 |
| PolarSurfaceArea | 141.05 |
| Druglikeness | 1.2914 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61905 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 3 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-nitro-2-[(Z)-[[2-(1,2,4-triazol-1-yl)acetyl]hydrazinylidene]methyl]phenolate | 2 - 4-nitro-2-[(Z)-[[2-(1,2,4-triazol-1-yl)acetyl]hydrazinylidene]methyl]phenolate