| MolName | N-[(Z)-[1-(2-amino-2-oxoethyl)indol-3-yl]methylideneamino]-3-hydroxy-4-iodobenzamide |
| MolecularFormula | C18H15N4O3I |
| Smiles | NC(Cn1c(cccc2)c2c(/C=N\NC(c(cc2)cc(O)c2I)=O)c1)=O |
| InChI | InChI=1S/C18H15IN4O3/c19-14-6-5-11(7-16(14)24)18(26)22-21-8-12-9-23(10-17(20)25)15-4-2-1-3-13(12)15/h1-9,24H,10H2,(H2,20,25)(H,22,26) |
| InChIK | XAULKIDBTCCRDE-UHFFFAOYSA-N |
| TotalMolweight | 462.242 |
| Molweight | 462.242 |
| MonoisotopicMass | 462.018889 |
| CLogP | 2.0471 |
| CLogS | -4.185 |
| H Acceptors | 7 |
| H Donors | 3 |
| TotalSurfaceArea | 283.45 |
| Relative PSA | 0.29737 |
| PolarSurfaceArea | 109.71 |
| Druglikeness | 7.4155 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57692 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[1-(2-amino-2-oxoethyl)indol-3-yl]methylideneamino]-3-hydroxy-4-iodobenzamide | 2 - N-[(Z)-[1-(2-amino-2-oxoethyl)indol-3-yl]methylideneamino]-3-hydroxy-4-iodobenzamide