| MolName | N-[(Z)-benzylideneamino]-3-[4-(2-phenylethoxy)phenyl]-1H-pyrazole-5-carboxamide |
| MolecularFormula | C25H22N4O2 |
| Smiles | O=C(c1cc(-c(cc2)ccc2OCCc2ccccc2)n[nH]1)N/N=C\c1ccccc1 |
| InChI | InChI=1S/C25H22N4O2/c30-25(29-26-18-20-9-5-2-6-10-20)24-17-23(27-28-24)21-11-13-22(14-12-21)31-16-15-19-7-3-1-4-8-19/h1-14,17-18H,15-16H2,(H,27,28)(H,29,30) |
| InChIK | XBGQOFWRZCKBLT-UHFFFAOYSA-N |
| TotalMolweight | 410.476 |
| Molweight | 410.476 |
| MonoisotopicMass | 410.174276 |
| CLogP | 4.6776 |
| CLogS | -5.549 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 332.36 |
| Relative PSA | 0.21353 |
| PolarSurfaceArea | 79.37 |
| Druglikeness | 5.0385 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.70968 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 3 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-benzylideneamino]-3-[4-(2-phenylethoxy)phenyl]-1H-pyrazole-5-carboxamide | 2 - N-[(Z)-benzylideneamino]-3-[4-(2-phenylethoxy)phenyl]-1H-pyrazole-5-carboxamide