| MolName | 4-[(Z)-thiophen-2-ylmethylideneamino]-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C7H6N4S2 |
| Smiles | S=C(NN=C1)N1/N=C\c1cccs1 |
| InChI | InChI=1S/C7H6N4S2/c12-7-10-8-5-11(7)9-4-6-2-1-3-13-6/h1-5H,(H,10,12) |
| InChIK | XBULCVWEOXXQDW-UHFFFAOYSA-N |
| TotalMolweight | 210.285 |
| Molweight | 210.285 |
| MonoisotopicMass | 210.003386 |
| CLogP | 1.5151 |
| CLogS | -3.46 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 159.69 |
| Relative PSA | 0.54099 |
| PolarSurfaceArea | 100.32 |
| Druglikeness | 5.4036 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.61538 |
| Fragments | 1 |
| Non HAtoms | 13 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 2 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 5 |
| Sp3Atoms | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-thiophen-2-ylmethylideneamino]-1H-1,2,4-triazole-5-thione | 2 - 4-[(Z)-thiophen-2-ylmethylideneamino]-1H-1,2,4-triazole-5-thione