| MolName | 2-[3-[(Z)-[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenoxy]acetic acid |
| MolecularFormula | C20H25N7O3 |
| Smiles | OC(COc1cc(/C=N\Nc2nc(N3CCCC3)nc(N3CCCC3)n2)ccc1)=O |
| InChI | InChI=1S/C20H25N7O3/c28-17(29)14-30-16-7-5-6-15(12-16)13-21-25-18-22-19(26-8-1-2-9-26)24-20(23-18)27-10-3-4-11-27/h5-7,12-13H,1-4,8-11,14H2,(H,28,29)(H,22,23,24,25) |
| InChIK | XBXPSTUCTUEWIK-UHFFFAOYSA-N |
| TotalMolweight | 411.465 |
| Molweight | 411.465 |
| MonoisotopicMass | 411.201888 |
| CLogP | 3.7933 |
| CLogS | -4.572 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 317.06 |
| Relative PSA | 0.31262 |
| PolarSurfaceArea | 116.07 |
| Druglikeness | 3.8453 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.53333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 11 |
| Symmetricatoms | 9 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[3-[(Z)-[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenoxy]acetic acid | 2 - 2-[3-[(Z)-[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenoxy]acetic acid