| MolName | (E)-1-(4-fluorophenyl)-N-(4-phenylpiperazin-1-yl)methanimine |
| MolecularFormula | C17H18N3F |
| Smiles | Fc1ccc(/C=N/N(CC2)CCN2c2ccccc2)cc1 |
| InChI | InChI=1S/C17H18FN3/c18-16-8-6-15(7-9-16)14-19-21-12-10-20(11-13-21)17-4-2-1-3-5-17/h1-9,14H,10-13H2 |
| InChIK | XCIOXAPXAYEYFR-UHFFFAOYSA-N |
| TotalMolweight | 283.349 |
| Molweight | 283.349 |
| MonoisotopicMass | 283.148475 |
| CLogP | 3.1969 |
| CLogS | -3.492 |
| H Acceptors | 3 |
| TotalSurfaceArea | 226.27 |
| Relative PSA | 0.082247 |
| PolarSurfaceArea | 18.84 |
| Druglikeness | 5.3861 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| Symmetricatoms | 6 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - (E)-1-(4-fluorophenyl)-N-(4-phenylpiperazin-1-yl)methanimine | 2 - (E)-1-(4-fluorophenyl)-N-(4-phenylpiperazin-1-yl)methanimine