| MolName | (Z)-N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]-1,1-diphenylmethanimine |
| MolecularFormula | C21H16N2OF2 |
| Smiles | FC(Oc1c(/C=N\N=C(c2ccccc2)c2ccccc2)cccc1)F |
| InChI | InChI=1S/C21H16F2N2O/c22-21(23)26-19-14-8-7-13-18(19)15-24-25-20(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-15,21H |
| InChIK | XCKVZPZNISDHPT-UHFFFAOYSA-N |
| TotalMolweight | 350.367 |
| Molweight | 350.367 |
| MonoisotopicMass | 350.123069 |
| CLogP | 6.1517 |
| CLogS | -6.53 |
| H Acceptors | 3 |
| TotalSurfaceArea | 275.71 |
| Relative PSA | 0.11976 |
| PolarSurfaceArea | 33.95 |
| Druglikeness | -1.0997 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 9 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]-1,1-diphenylmethanimine | 2 - (Z)-N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]-1,1-diphenylmethanimine