| MolName | N-[(Z)-(2-bromophenyl)methylideneamino]-4-[(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]benzamide |
| MolecularFormula | C25H18N3O3BrS |
| Smiles | O=C(c1ccc(CN(c2cccc3cccc4c23)S4(=O)=O)cc1)N/N=C\c(cccc1)c1Br |
| InChI | InChI=1S/C25H18BrN3O3S/c26-21-8-2-1-5-20(21)15-27-28-25(30)19-13-11-17(12-14-19)16-29-22-9-3-6-18-7-4-10-23(24(18)22)33(29,31)32/h1-15H,16H2,(H,28,30) |
| InChIK | XCLJXRJSVKNQKC-UHFFFAOYSA-N |
| TotalMolweight | 520.406 |
| Molweight | 520.406 |
| MonoisotopicMass | 519.025223 |
| CLogP | 5.5218 |
| CLogS | -7.841 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 339.12 |
| Relative PSA | 0.20093 |
| PolarSurfaceArea | 87.22 |
| Druglikeness | -2.7186 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54545 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 3 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-bromophenyl)methylideneamino]-4-[(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]benzamide | 2 - N-[(Z)-(2-bromophenyl)methylideneamino]-4-[(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]benzamide