| MolName | 1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[(Z)-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylideneamino]thiourea |
| MolecularFormula | C29H27N6O5ClS2 |
| Smiles | O=S(c(cc1)cc(NC(N/N=C\c2cn(-c3ccccc3)nc2-c(cc2)cc3c2OCCO3)=S)c1Cl)(N1CCOCC1)=O |
| InChI | InChI=1S/C29H27ClN6O5S2/c30-24-8-7-23(43(37,38)35-10-12-39-13-11-35)17-25(24)32-29(42)33-31-18-21-19-36(22-4-2-1-3-5-22)34-28(21)20-6-9-26-27(16-20)41-15-14-40-26/h1-9,16-19H,10-15H2,(H2,32,33,42) |
| InChIK | XCMSDAPXYQNSLS-UHFFFAOYSA-N |
| TotalMolweight | 639.155 |
| Molweight | 639.155 |
| MonoisotopicMass | 638.117286 |
| CLogP | 4.1388 |
| CLogS | -5.958 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 460.75 |
| Relative PSA | 0.30906 |
| PolarSurfaceArea | 159.78 |
| Druglikeness | -1.5387 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.48837 |
| Fragments | 1 |
| Non HAtoms | 43 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 6 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 11 |
| Symmetricatoms | 5 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[(Z)-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylideneamino]thiourea | 2 - 1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[(Z)-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylideneamino]thiourea