| MolName | 3,5-dichloro-2-hydroxy-N-[(Z)-(3-nitrophenyl)methylideneamino]benzamide |
| MolecularFormula | C14H9N3O4Cl2 |
| Smiles | [O-][N+](c1cccc(/C=N\NC(c2cc(Cl)cc(Cl)c2O)=O)c1)=O |
| InChI | InChI=1S/C14H9Cl2N3O4/c15-9-5-11(13(20)12(16)6-9)14(21)18-17-7-8-2-1-3-10(4-8)19(22)23/h1-7,20H,(H,18,21) |
| InChIK | XDDQNFTXMGEFBN-UHFFFAOYSA-N |
| TotalMolweight | 354.148 |
| Molweight | 354.148 |
| MonoisotopicMass | 352.997011 |
| CLogP | 3.1463 |
| CLogS | -5.357 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 247.85 |
| Relative PSA | 0.32088 |
| PolarSurfaceArea | 107.51 |
| Druglikeness | -0.7535 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.56522 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3,5-dichloro-2-hydroxy-N-[(Z)-(3-nitrophenyl)methylideneamino]benzamide | 2 - 3,5-dichloro-2-hydroxy-N-[(Z)-(3-nitrophenyl)methylideneamino]benzamide