| MolName | N-[(Z)-(4,5-dibromofuran-2-yl)methylideneamino]pyridin-2-amine |
| MolecularFormula | C10H7N3OBr2 |
| Smiles | Brc(cc(/C=N\Nc1ncccc1)o1)c1Br |
| InChI | InChI=1S/C10H7Br2N3O/c11-8-5-7(16-10(8)12)6-14-15-9-3-1-2-4-13-9/h1-6H,(H,13,15) |
| InChIK | XDRPOZSTMIDEDN-UHFFFAOYSA-N |
| TotalMolweight | 344.994 |
| Molweight | 344.994 |
| MonoisotopicMass | 342.895584 |
| CLogP | 4.9279 |
| CLogS | -3.992 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 194.95 |
| Relative PSA | 0.24647 |
| PolarSurfaceArea | 50.42 |
| Druglikeness | -3.1675 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | 1,2-dihalo-alkene; imine/hydrazone of aldehyde |
| Shape Index | 0.6875 |
| Fragments | 1 |
| Non HAtoms | 16 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4,5-dibromofuran-2-yl)methylideneamino]pyridin-2-amine | 2 - N-[(Z)-(4,5-dibromofuran-2-yl)methylideneamino]pyridin-2-amine