| MolName | 4-[5-[(Z)-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)iminomethyl]furan-2-yl]benzoic acid |
| MolecularFormula | C22H17N3O4S |
| Smiles | OC(c(cc1)ccc1-c1ccc(/C=N\N(C=Nc2c3c(CCCC4)c4s2)C3=O)o1)=O |
| InChI | InChI=1S/C22H17N3O4S/c26-21-19-16-3-1-2-4-18(16)30-20(19)23-12-25(21)24-11-15-9-10-17(29-15)13-5-7-14(8-6-13)22(27)28/h5-12H,1-4H2,(H,27,28) |
| InChIK | XDVBQFQMUZASQM-UHFFFAOYSA-N |
| TotalMolweight | 419.46 |
| Molweight | 419.46 |
| MonoisotopicMass | 419.093977 |
| CLogP | 4.109 |
| CLogS | -6.524 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 308.12 |
| Relative PSA | 0.32526 |
| PolarSurfaceArea | 123.71 |
| Druglikeness | 3.2461 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[5-[(Z)-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)iminomethyl]furan-2-yl]benzoic acid | 2 - 4-[5-[(Z)-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)iminomethyl]furan-2-yl]benzoic acid