| MolName | N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide |
| MolecularFormula | C32H23N3O2 |
| Smiles | Oc1cc2ccccc2cc1C(N/N=C\c(c1c2cccc1)c(-c1ccccc1)n2-c1ccccc1)=O |
| InChI | InChI=1S/C32H23N3O2/c36-30-20-24-14-8-7-13-23(24)19-27(30)32(37)34-33-21-28-26-17-9-10-18-29(26)35(25-15-5-2-6-16-25)31(28)22-11-3-1-4-12-22/h1-21,36H,(H,34,37) |
| InChIK | XDZKJCVAIYSJEL-UHFFFAOYSA-N |
| TotalMolweight | 481.554 |
| Molweight | 481.554 |
| MonoisotopicMass | 481.179027 |
| CLogP | 7.3023 |
| CLogS | -10.623 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 371.26 |
| Relative PSA | 0.15078 |
| PolarSurfaceArea | 66.62 |
| Druglikeness | 5.4335 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.45946 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 5 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 6 |
| Aromatic Atoms | 31 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide | 2 - N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide