| MolName | 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]acetamide |
| MolecularFormula | C19H19N4O3BrCl2S |
| Smiles | O=C(CN(CC1)CCN1S(c(cc1)ccc1Br)(=O)=O)N/N=C\c(cc1)cc(Cl)c1Cl |
| InChI | InChI=1S/C19H19BrCl2N4O3S/c20-15-2-4-16(5-3-15)30(28,29)26-9-7-25(8-10-26)13-19(27)24-23-12-14-1-6-17(21)18(22)11-14/h1-6,11-12H,7-10,13H2,(H,24,27) |
| InChIK | XEDBLGKOBBSITK-UHFFFAOYSA-N |
| TotalMolweight | 534.261 |
| Molweight | 534.261 |
| MonoisotopicMass | 531.973826 |
| CLogP | 3.9359 |
| CLogS | -4.497 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 340.94 |
| Relative PSA | 0.21027 |
| PolarSurfaceArea | 90.46 |
| Druglikeness | 6.99 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 7 |
| Symmetricatoms | 5 |
| Amides | 1 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]acetamide | 2 - 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]acetamide