| MolName | N-[(Z)-[(E)-3-(furan-2-yl)prop-2-enylidene]amino]-2,6-dimorpholin-4-ylpyrimidin-4-amine |
| MolecularFormula | C19H24N6O3 |
| Smiles | C(COCC1)N1c1cc(N/N=C\C=C\c2ccco2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C19H24N6O3/c1(3-16-4-2-10-28-16)5-20-23-17-15-18(24-6-11-26-12-7-24)22-19(21-17)25-8-13-27-14-9-25/h1-5,10,15H,6-9,11-14H2,(H,21,22,23) |
| InChIK | XEYWYOUOCWGJJG-UHFFFAOYSA-N |
| TotalMolweight | 384.439 |
| Molweight | 384.439 |
| MonoisotopicMass | 384.190989 |
| CLogP | 2.895 |
| CLogS | -3.646 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 306.63 |
| Relative PSA | 0.28086 |
| PolarSurfaceArea | 88.25 |
| Druglikeness | 3.118 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.53571 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 10 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[(E)-3-(furan-2-yl)prop-2-enylidene]amino]-2,6-dimorpholin-4-ylpyrimidin-4-amine | 2 - N-[(Z)-[(E)-3-(furan-2-yl)prop-2-enylidene]amino]-2,6-dimorpholin-4-ylpyrimidin-4-amine