| MolName | (2Z)-2-[(Z)-benzylidenehydrazinylidene]-1,2-diphenylethanone |
| MolecularFormula | C21H16N2O |
| Smiles | O=C(/C(/c1ccccc1)=N\N=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H16N2O/c24-21(19-14-8-3-9-15-19)20(18-12-6-2-7-13-18)23-22-16-17-10-4-1-5-11-17/h1-16H |
| InChIK | XFSKNGLQBGHAIV-UHFFFAOYSA-N |
| TotalMolweight | 312.371 |
| Molweight | 312.371 |
| MonoisotopicMass | 312.126263 |
| CLogP | 5.2771 |
| CLogS | -5.808 |
| H Acceptors | 3 |
| TotalSurfaceArea | 258.26 |
| Relative PSA | 0.13963 |
| PolarSurfaceArea | 41.79 |
| Druglikeness | 2.7972 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.54167 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - (2Z)-2-[(Z)-benzylidenehydrazinylidene]-1,2-diphenylethanone | 2 - (2Z)-2-[(Z)-benzylidenehydrazinylidene]-1,2-diphenylethanone