| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(1,3-benzodioxol-5-yl)-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]triazole-4-carboxamide |
| MolecularFormula | C20H14N8O6 |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c(cc2)cc3c2OCO3)=O)c1-c(cc1)cc2c1OCO2 |
| InChI | InChI=1S/C20H14N8O6/c21-18-19(26-34-25-18)28-17(11-2-4-13-15(6-11)33-9-31-13)16(23-27-28)20(29)24-22-7-10-1-3-12-14(5-10)32-8-30-12/h1-7H,8-9H2,(H2,21,25)(H,24,29) |
| InChIK | XFWXYJHOGZJIDF-UHFFFAOYSA-N |
| TotalMolweight | 462.381 |
| Molweight | 462.381 |
| MonoisotopicMass | 462.103632 |
| CLogP | 3.6684 |
| CLogS | -4.628 |
| H Acceptors | 14 |
| H Donors | 2 |
| TotalSurfaceArea | 329.48 |
| Relative PSA | 0.4739 |
| PolarSurfaceArea | 174.03 |
| Druglikeness | 1.8775 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.47059 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 5 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 6 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(1,3-benzodioxol-5-yl)-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(1,3-benzodioxol-5-yl)-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]triazole-4-carboxamide