| MolName | 2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]acetamide |
| MolecularFormula | C24H16N4O2ClF3S |
| Smiles | O=C(CSC(N1c(cc2)ccc2Cl)=Nc(cccc2)c2C1=O)N/N=C\c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H16ClF3N4O2S/c25-17-9-11-18(12-10-17)32-22(34)19-3-1-2-4-20(19)30-23(32)35-14-21(33)31-29-13-15-5-7-16(8-6-15)24(26,27)28/h1-13H,14H2,(H,31,33) |
| InChIK | XGMCSNPFXZAIQW-UHFFFAOYSA-N |
| TotalMolweight | 516.93 |
| Molweight | 516.93 |
| MonoisotopicMass | 516.063457 |
| CLogP | 5.6648 |
| CLogS | -7.639 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 360.4 |
| Relative PSA | 0.22642 |
| PolarSurfaceArea | 99.43 |
| Druglikeness | -1.4392 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54286 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 6 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]acetamide | 2 - 2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]acetamide