| MolName | N-[(E)-1-(1,3-benzodioxol-5-yl)-3-[(2Z)-2-(naphthalen-2-ylmethylidene)hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
| MolecularFormula | C28H21N3O4 |
| Smiles | O=C(/C(/NC(c1ccccc1)=O)=C\c(cc1)cc2c1OCO2)N/N=C\c1cc2ccccc2cc1 |
| InChI | InChI=1S/C28H21N3O4/c32-27(22-7-2-1-3-8-22)30-24(15-19-11-13-25-26(16-19)35-18-34-25)28(33)31-29-17-20-10-12-21-6-4-5-9-23(21)14-20/h1-17H,18H2,(H,30,32)(H,31,33) |
| InChIK | XGNVHZJZQZQELI-UHFFFAOYSA-N |
| TotalMolweight | 463.492 |
| Molweight | 463.492 |
| MonoisotopicMass | 463.153207 |
| CLogP | 6.1241 |
| CLogS | -7.783 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 355.53 |
| Relative PSA | 0.22645 |
| PolarSurfaceArea | 89.02 |
| Druglikeness | 6.2698 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48571 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(E)-1-(1,3-benzodioxol-5-yl)-3-[(2Z)-2-(naphthalen-2-ylmethylidene)hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide | 2 - N-[(E)-1-(1,3-benzodioxol-5-yl)-3-[(2Z)-2-(naphthalen-2-ylmethylidene)hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide