| MolName | N-[(Z)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-2-naphthalen-1-ylacetamide |
| MolecularFormula | C23H17N2O2Cl |
| Smiles | O=C(Cc1cccc2ccccc12)N/N=C\c1ccc(-c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C23H17ClN2O2/c24-19-9-4-8-18(13-19)22-12-11-20(28-22)15-25-26-23(27)14-17-7-3-6-16-5-1-2-10-21(16)17/h1-13,15H,14H2,(H,26,27) |
| InChIK | XGPSITMKPVXQGI-UHFFFAOYSA-N |
| TotalMolweight | 388.853 |
| Molweight | 388.853 |
| MonoisotopicMass | 388.097855 |
| CLogP | 5.939 |
| CLogS | -7.488 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 300.22 |
| Relative PSA | 0.16694 |
| PolarSurfaceArea | 54.6 |
| Druglikeness | 6.4874 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.60714 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-2-naphthalen-1-ylacetamide | 2 - N-[(Z)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-2-naphthalen-1-ylacetamide