| MolName | N-[(Z)-naphthalen-1-ylmethylideneamino]-1,1-dioxo-1,2-benzothiazol-3-amine |
| MolecularFormula | C18H13N3O2S |
| Smiles | O=S(c1c2cccc1)(N=C2N/N=C\c1cccc2ccccc12)=O |
| InChI | InChI=1S/C18H13N3O2S/c22-24(23)17-11-4-3-10-16(17)18(21-24)20-19-12-14-8-5-7-13-6-1-2-9-15(13)14/h1-12H,(H,20,21) |
| InChIK | XGQZNTLXOMDFBA-UHFFFAOYSA-N |
| TotalMolweight | 335.386 |
| Molweight | 335.386 |
| MonoisotopicMass | 335.072847 |
| CLogP | 4.0339 |
| CLogS | -5.333 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 241.89 |
| Relative PSA | 0.2607 |
| PolarSurfaceArea | 79.27 |
| Druglikeness | 2.7033 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.54167 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 2 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 1 |
| Symmetricatoms | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-naphthalen-1-ylmethylideneamino]-1,1-dioxo-1,2-benzothiazol-3-amine | 2 - N-[(Z)-naphthalen-1-ylmethylideneamino]-1,1-dioxo-1,2-benzothiazol-3-amine