| MolName | 2-[4-[(Z)-[[2-[5-(2-chlorophenyl)tetrazol-2-yl]acetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| MolecularFormula | C18H15N6O4Cl |
| Smiles | OC(COc1ccc(/C=N\NC(Cn2nnc(-c(cccc3)c3Cl)n2)=O)cc1)=O |
| InChI | InChI=1S/C18H15ClN6O4/c19-15-4-2-1-3-14(15)18-22-24-25(23-18)10-16(26)21-20-9-12-5-7-13(8-6-12)29-11-17(27)28/h1-9H,10-11H2,(H,21,26)(H,27,28) |
| InChIK | XHAMSGLNDVHYRQ-UHFFFAOYSA-N |
| TotalMolweight | 414.808 |
| Molweight | 414.808 |
| MonoisotopicMass | 414.084331 |
| CLogP | 2.1789 |
| CLogS | -4.318 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 309.27 |
| Relative PSA | 0.36192 |
| PolarSurfaceArea | 131.59 |
| Druglikeness | 0.90809 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68966 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[4-[(Z)-[[2-[5-(2-chlorophenyl)tetrazol-2-yl]acetyl]hydrazinylidene]methyl]phenoxy]acetic acid | 2 - 2-[4-[(Z)-[[2-[5-(2-chlorophenyl)tetrazol-2-yl]acetyl]hydrazinylidene]methyl]phenoxy]acetic acid