| MolName | N-cyclohexyl-2-[(Z)-(2,3-dichlorophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| MolecularFormula | C22H24N2OCl2S |
| Smiles | O=C(c1c(/N=C\c2cccc(Cl)c2Cl)sc2c1CCCC2)NC1CCCCC1 |
| InChI | InChI=1S/C22H24Cl2N2OS/c23-17-11-6-7-14(20(17)24)13-25-22-19(16-10-4-5-12-18(16)28-22)21(27)26-15-8-2-1-3-9-15/h6-7,11,13,15H,1-5,8-10,12H2,(H,26,27) |
| InChIK | XHJRXSMLTWHYRJ-UHFFFAOYSA-N |
| TotalMolweight | 435.418 |
| Molweight | 435.418 |
| MonoisotopicMass | 434.098637 |
| CLogP | 6.4529 |
| CLogS | -7.461 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 323.11 |
| Relative PSA | 0.17446 |
| PolarSurfaceArea | 69.7 |
| Druglikeness | 0.38103 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 10 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-cyclohexyl-2-[(Z)-(2,3-dichlorophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide | 2 - N-cyclohexyl-2-[(Z)-(2,3-dichlorophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide