| MolName | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-N'-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]oxamide |
| MolecularFormula | C20H18N4O2S |
| Smiles | N#Cc1c(NC(C(N/N=C\C=C\c2ccccc2)=O)=O)sc2c1CCCC2 |
| InChI | InChI=1S/C20H18N4O2S/c21-13-16-15-10-4-5-11-17(15)27-20(16)23-18(25)19(26)24-22-12-6-9-14-7-2-1-3-8-14/h1-3,6-9,12H,4-5,10-11H2,(H,23,25)(H,24,26) |
| InChIK | XHNBEIDAXZUYBN-UHFFFAOYSA-N |
| TotalMolweight | 378.455 |
| Molweight | 378.455 |
| MonoisotopicMass | 378.115046 |
| CLogP | 3.2108 |
| CLogS | -5.842 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 301.89 |
| Relative PSA | 0.3128 |
| PolarSurfaceArea | 122.59 |
| Druglikeness | -4.2858 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.62963 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-N'-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]oxamide | 2 - N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-N'-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]oxamide