| MolName | 3-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-one |
| MolecularFormula | C17H10N4O4S |
| Smiles | [O-][N+](c1ccc(/C=N\N(C=Nc2c3c(-c4ccccc4)cs2)C3=O)o1)=O |
| InChI | InChI=1S/C17H10N4O4S/c22-17-15-13(11-4-2-1-3-5-11)9-26-16(15)18-10-20(17)19-8-12-6-7-14(25-12)21(23)24/h1-10H |
| InChIK | XHPXBAZDGWJAFK-UHFFFAOYSA-N |
| TotalMolweight | 366.356 |
| Molweight | 366.356 |
| MonoisotopicMass | 366.042276 |
| CLogP | 2.7237 |
| CLogS | -6.602 |
| H Acceptors | 8 |
| TotalSurfaceArea | 266.15 |
| Relative PSA | 0.39264 |
| PolarSurfaceArea | 132.23 |
| Druglikeness | 4.6164 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.57692 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-one | 2 - 3-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-one