| MolName | (Z)-1,1-diphenyl-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]methanimine |
| MolecularFormula | C21H15N2F3 |
| Smiles | FC(c1c(/C=N\N=C(c2ccccc2)c2ccccc2)cccc1)(F)F |
| InChI | InChI=1S/C21H15F3N2/c22-21(23,24)19-14-8-7-13-18(19)15-25-26-20(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-15H |
| InChIK | XHVWNXPOZIOJNI-UHFFFAOYSA-N |
| TotalMolweight | 352.358 |
| Molweight | 352.358 |
| MonoisotopicMass | 352.118732 |
| CLogP | 6.8306 |
| CLogS | -6.686 |
| H Acceptors | 2 |
| TotalSurfaceArea | 269.97 |
| Relative PSA | 0.085269 |
| PolarSurfaceArea | 24.72 |
| Druglikeness | -5.2481 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.46154 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| Symmetricatoms | 10 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1,1-diphenyl-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]methanimine | 2 - (Z)-1,1-diphenyl-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]methanimine