| MolName | 2-amino-1-[(Z)-furan-2-ylmethylideneamino]-N-[[(2S)-oxolan-2-yl]methyl]pyrrolo[3,2-b]quinoxaline-3-carboxamide |
| MolecularFormula | C21H20N6O3 |
| Smiles | Nc1c(C(NC[C@H]2OCCC2)=O)c2nc3ccccc3nc2n1/N=C\c1ccco1 |
| InChI | InChI=1S/C21H20N6O3/c22-19-17(21(28)23-11-13-5-3-9-29-13)18-20(26-16-8-2-1-7-15(16)25-18)27(19)24-12-14-6-4-10-30-14/h1-2,4,6-8,10,12-13H,3,5,9,11,22H2,(H,23,28)/t13-/m0/s1 |
| InChIK | XHYOIEIRLFMLBH-ZDUSSCGKSA-N |
| TotalMolweight | 404.429 |
| Molweight | 404.429 |
| MonoisotopicMass | 404.159689 |
| CLogP | 1.9422 |
| CLogS | -7.404 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 305.16 |
| Relative PSA | 0.34146 |
| PolarSurfaceArea | 120.56 |
| Druglikeness | 4.2467 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.46667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| StereoCenters | 1 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 7 |
| Amides | 1 |
| Aromatic Nitrogens | 3 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - 2-amino-1-[(Z)-furan-2-ylmethylideneamino]-N-[[(2S)-oxolan-2-yl]methyl]pyrrolo[3,2-b]quinoxaline-3-carboxamide | 2 - 2-amino-1-[(Z)-furan-2-ylmethylideneamino]-N-[[(2S)-oxolan-2-yl]methyl]pyrrolo[3,2-b]quinoxaline-3-carboxamide