| MolName | 6-chloro-N-[(Z)-(2-chlorophenyl)methylideneamino]-2-phenylpyrimidin-4-amine |
| MolecularFormula | C17H12N4Cl2 |
| Smiles | Clc1c(/C=N\Nc2cc(Cl)nc(-c3ccccc3)n2)cccc1 |
| InChI | InChI=1S/C17H12Cl2N4/c18-14-9-5-4-8-13(14)11-20-23-16-10-15(19)21-17(22-16)12-6-2-1-3-7-12/h1-11H,(H,21,22,23) |
| InChIK | XIAKAXCUFITRKG-UHFFFAOYSA-N |
| TotalMolweight | 343.216 |
| Molweight | 343.216 |
| MonoisotopicMass | 342.0439 |
| CLogP | 6.5815 |
| CLogS | -6.05 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 257.36 |
| Relative PSA | 0.1745 |
| PolarSurfaceArea | 50.17 |
| Druglikeness | 2.3845 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.6087 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 6-chloro-N-[(Z)-(2-chlorophenyl)methylideneamino]-2-phenylpyrimidin-4-amine | 2 - 6-chloro-N-[(Z)-(2-chlorophenyl)methylideneamino]-2-phenylpyrimidin-4-amine