| MolName | 2,2,2-trifluoro-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]acetamide |
| MolecularFormula | C10H6N3O5F3 |
| Smiles | [O-][N+](c1c(/C=N\NC(C(F)(F)F)=O)cc2OCOc2c1)=O |
| InChI | InChI=1S/C10H6F3N3O5/c11-10(12,13)9(17)15-14-3-5-1-7-8(21-4-20-7)2-6(5)16(18)19/h1-3H,4H2,(H,15,17) |
| InChIK | XICBJPQLBIKJRL-UHFFFAOYSA-N |
| TotalMolweight | 305.168 |
| Molweight | 305.168 |
| MonoisotopicMass | 305.025956 |
| CLogP | 1.4319 |
| CLogS | -4.462 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 200.62 |
| Relative PSA | 0.43081 |
| PolarSurfaceArea | 105.74 |
| Druglikeness | -28.312 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52381 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2,2,2-trifluoro-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]acetamide | 2 - 2,2,2-trifluoro-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]acetamide