| MolName | [4-[(Z)-[[2-(4-bromophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-(2,4-dichlorophenoxy)butanoate |
| MolecularFormula | C25H21N2O5BrCl2 |
| Smiles | O=C(COc(cc1)ccc1Br)N/N=C\c(cc1)ccc1OC(CCCOc(ccc(Cl)c1)c1Cl)=O |
| InChI | InChI=1S/C25H21BrCl2N2O5/c26-18-5-10-20(11-6-18)34-16-24(31)30-29-15-17-3-8-21(9-4-17)35-25(32)2-1-13-33-23-12-7-19(27)14-22(23)28/h3-12,14-15H,1-2,13,16H2,(H,30,31) |
| InChIK | XIDBNPKMVCXSTR-UHFFFAOYSA-N |
| TotalMolweight | 580.261 |
| Molweight | 580.261 |
| MonoisotopicMass | 578.001088 |
| CLogP | 6.6279 |
| CLogS | -7.597 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 399.01 |
| Relative PSA | 0.19812 |
| PolarSurfaceArea | 86.22 |
| Druglikeness | -3.9839 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.74286 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 12 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 7 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[2-(4-bromophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-(2,4-dichlorophenoxy)butanoate | 2 - [4-[(Z)-[[2-(4-bromophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-(2,4-dichlorophenoxy)butanoate