| MolName | [2,4-dibromo-6-[(Z)-[[2-(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-iodobenzoate |
| MolecularFormula | C22H14N2O4Br2ClI |
| Smiles | O=C(COc(cc1)ccc1Cl)N/N=C\c1cc(Br)cc(Br)c1OC(c(cccc1)c1I)=O |
| InChI | InChI=1S/C22H14Br2ClIN2O4/c23-14-9-13(11-27-28-20(29)12-31-16-7-5-15(25)6-8-16)21(18(24)10-14)32-22(30)17-3-1-2-4-19(17)26/h1-11H,12H2,(H,28,29) |
| InChIK | XIFVRCAINKHAME-UHFFFAOYSA-N |
| TotalMolweight | 692.524 |
| Molweight | 692.524 |
| MonoisotopicMass | 689.805355 |
| CLogP | 6.7005 |
| CLogS | -8.391 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 377.22 |
| Relative PSA | 0.18305 |
| PolarSurfaceArea | 76.99 |
| Druglikeness | 2.6811 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.59375 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - [2,4-dibromo-6-[(Z)-[[2-(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-iodobenzoate | 2 - [2,4-dibromo-6-[(Z)-[[2-(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-iodobenzoate