| MolName | N-[(Z)-furan-3-ylmethylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
| MolecularFormula | C14H9N3O4S |
| Smiles | [O-][N+](c(cc1)cc2c1sc(C(N/N=C\c1cocc1)=O)c2)=O |
| InChI | InChI=1S/C14H9N3O4S/c18-14(16-15-7-9-3-4-21-8-9)13-6-10-5-11(17(19)20)1-2-12(10)22-13/h1-8H,(H,16,18) |
| InChIK | XIGVQOQLJULXII-UHFFFAOYSA-N |
| TotalMolweight | 315.308 |
| Molweight | 315.308 |
| MonoisotopicMass | 315.031377 |
| CLogP | 2.3359 |
| CLogS | -5.188 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 230.89 |
| Relative PSA | 0.437 |
| PolarSurfaceArea | 128.66 |
| Druglikeness | 0.38353 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 14 |
| Sp3Atoms | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-furan-3-ylmethylideneamino]-5-nitro-1-benzothiophene-2-carboxamide | 2 - N-[(Z)-furan-3-ylmethylideneamino]-5-nitro-1-benzothiophene-2-carboxamide