| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(2,3-dihydroindol-1-ylmethyl)-N-[(Z)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]triazole-4-carboxamide |
| MolecularFormula | C25H20N10O5 |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c2ccc(-c3cccc([N+]([O-])=O)c3)o2)=O)c1CN(CC1)c2c1cccc2 |
| InChI | InChI=1S/C25H20N10O5/c26-23-24(31-40-30-23)34-20(14-33-11-10-15-4-1-2-7-19(15)33)22(28-32-34)25(36)29-27-13-18-8-9-21(39-18)16-5-3-6-17(12-16)35(37)38/h1-9,12-13H,10-11,14H2,(H2,26,30)(H,29,36) |
| InChIK | XIHVIGFNNMUFHY-UHFFFAOYSA-N |
| TotalMolweight | 540.499 |
| Molweight | 540.499 |
| MonoisotopicMass | 540.161815 |
| CLogP | 3.2186 |
| CLogS | -5.08 |
| H Acceptors | 15 |
| H Donors | 2 |
| TotalSurfaceArea | 400.16 |
| Relative PSA | 0.41039 |
| PolarSurfaceArea | 199.31 |
| Druglikeness | 0.031244 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 40 |
| NonCHAtoms | 15 |
| Electronegative Atoms | 15 |
| Rotatable Bond | 8 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Sp3Atoms | 5 |
| Amines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 5 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(2,3-dihydroindol-1-ylmethyl)-N-[(Z)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(2,3-dihydroindol-1-ylmethyl)-N-[(Z)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]triazole-4-carboxamide