| MolName | N-[(Z)-(4-phenoxyphenyl)methylideneamino]-2,5-bis(2,2,2-trifluoroethoxy)benzamide |
| MolecularFormula | C24H18N2O4F6 |
| Smiles | O=C(c(cc(cc1)OCC(F)(F)F)c1OCC(F)(F)F)N/N=C\c(cc1)ccc1Oc1ccccc1 |
| InChI | InChI=1S/C24H18F6N2O4/c25-23(26,27)14-34-19-10-11-21(35-15-24(28,29)30)20(12-19)22(33)32-31-13-16-6-8-18(9-7-16)36-17-4-2-1-3-5-17/h1-13H,14-15H2,(H,32,33) |
| InChIK | XILYUBONGSXQDP-UHFFFAOYSA-N |
| TotalMolweight | 512.405 |
| Molweight | 512.405 |
| MonoisotopicMass | 512.117076 |
| CLogP | 6.2384 |
| CLogS | -8.134 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 363.19 |
| Relative PSA | 0.18175 |
| PolarSurfaceArea | 69.15 |
| Druglikeness | -2.7024 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 11 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 7 |
| Symmetricatoms | 8 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-phenoxyphenyl)methylideneamino]-2,5-bis(2,2,2-trifluoroethoxy)benzamide | 2 - N-[(Z)-(4-phenoxyphenyl)methylideneamino]-2,5-bis(2,2,2-trifluoroethoxy)benzamide