| MolName | (E)-N-[3-(1,3-benzoxazol-2-yl)phenyl]-3-(2,4-dichlorophenyl)prop-2-en-1-imine |
| MolecularFormula | C22H14N2OCl2 |
| Smiles | Clc1cc(Cl)c(/C=C/C=N/c2cc(-c3nc(cccc4)c4o3)ccc2)cc1 |
| InChI | InChI=1S/C22H14Cl2N2O/c23-17-11-10-15(19(24)14-17)6-4-12-25-18-7-3-5-16(13-18)22-26-20-8-1-2-9-21(20)27-22/h1-14H |
| InChIK | XIMDVYJOEZPUNX-UHFFFAOYSA-N |
| TotalMolweight | 393.272 |
| Molweight | 393.272 |
| MonoisotopicMass | 392.048317 |
| CLogP | 5.9185 |
| CLogS | -7.912 |
| H Acceptors | 3 |
| TotalSurfaceArea | 297.93 |
| Relative PSA | 0.12281 |
| PolarSurfaceArea | 38.39 |
| Druglikeness | 0.1 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.62963 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (E)-N-[3-(1,3-benzoxazol-2-yl)phenyl]-3-(2,4-dichlorophenyl)prop-2-en-1-imine | 2 - (E)-N-[3-(1,3-benzoxazol-2-yl)phenyl]-3-(2,4-dichlorophenyl)prop-2-en-1-imine