| MolName | 4-amino-N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]benzamide |
| MolecularFormula | C16H18N4O2S |
| Smiles | Nc(cc1)ccc1C(N/N=C\c1ccc(N2CCOCC2)s1)=O |
| InChI | InChI=1S/C16H18N4O2S/c17-13-3-1-12(2-4-13)16(21)19-18-11-14-5-6-15(23-14)20-7-9-22-10-8-20/h1-6,11H,7-10,17H2,(H,19,21) |
| InChIK | XINPPRQCQAVBDZ-UHFFFAOYSA-N |
| TotalMolweight | 330.411 |
| Molweight | 330.411 |
| MonoisotopicMass | 330.115046 |
| CLogP | 2.2495 |
| CLogS | -4.06 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 253.29 |
| Relative PSA | 0.33633 |
| PolarSurfaceArea | 108.19 |
| Druglikeness | 6.2652 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.69565 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-amino-N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]benzamide | 2 - 4-amino-N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]benzamide