| MolName | 3-[2-[(2Z)-2-[(2-chlorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]chromen-2-one |
| MolecularFormula | C19H12N3O2ClS |
| Smiles | O=C1Oc(cccc2)c2C=C1c1csc(N/N=C\c(cccc2)c2Cl)n1 |
| InChI | InChI=1S/C19H12ClN3O2S/c20-15-7-3-1-6-13(15)10-21-23-19-22-16(11-26-19)14-9-12-5-2-4-8-17(12)25-18(14)24/h1-11H,(H,22,23) |
| InChIK | XISIYVMTYZMATQ-UHFFFAOYSA-N |
| TotalMolweight | 381.842 |
| Molweight | 381.842 |
| MonoisotopicMass | 381.033874 |
| CLogP | 6.2192 |
| CLogS | -5.353 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 278.08 |
| Relative PSA | 0.27812 |
| PolarSurfaceArea | 91.82 |
| Druglikeness | 4.3896 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.61538 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[2-[(2Z)-2-[(2-chlorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]chromen-2-one | 2 - 3-[2-[(2Z)-2-[(2-chlorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]chromen-2-one