| MolName | N-[(Z)-1-(4-nitrophenyl)-3-[(2Z)-2-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
| MolecularFormula | C27H20N6O6 |
| Smiles | [O-][N+](c1ccc(/C=C(/C(N/N=C\c2cccn2-c(cc2)ccc2[N+]([O-])=O)=O)\NC(c2ccccc2)=O)cc1)=O |
| InChI | InChI=1S/C27H20N6O6/c34-26(20-5-2-1-3-6-20)29-25(17-19-8-10-22(11-9-19)32(36)37)27(35)30-28-18-24-7-4-16-31(24)21-12-14-23(15-13-21)33(38)39/h1-18H,(H,29,34)(H,30,35) |
| InChIK | XJCWJVXWGWGZCU-UHFFFAOYSA-N |
| TotalMolweight | 524.492 |
| Molweight | 524.492 |
| MonoisotopicMass | 524.144434 |
| CLogP | 3.214 |
| CLogS | -8.723 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 396.97 |
| Relative PSA | 0.323 |
| PolarSurfaceArea | 167.13 |
| Druglikeness | 1.8666 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51282 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-1-(4-nitrophenyl)-3-[(2Z)-2-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide | 2 - N-[(Z)-1-(4-nitrophenyl)-3-[(2Z)-2-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide