| MolName | N-[(Z)-[1-[(3-fluorophenyl)methyl]indol-5-yl]methylideneamino]pyridine-3-carboxamide |
| MolecularFormula | C22H17N4OF |
| Smiles | O=C(c1cnccc1)N/N=C\c(cc1)cc2c1n(Cc1cccc(F)c1)cc2 |
| InChI | InChI=1S/C22H17FN4O/c23-20-5-1-3-17(12-20)15-27-10-8-18-11-16(6-7-21(18)27)13-25-26-22(28)19-4-2-9-24-14-19/h1-14H,15H2,(H,26,28) |
| InChIK | XJZYPPYFEILRHX-UHFFFAOYSA-N |
| TotalMolweight | 372.402 |
| Molweight | 372.402 |
| MonoisotopicMass | 372.138639 |
| CLogP | 3.8312 |
| CLogS | -4.218 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 289.42 |
| Relative PSA | 0.18606 |
| PolarSurfaceArea | 59.28 |
| Druglikeness | 4.6 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64286 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[1-[(3-fluorophenyl)methyl]indol-5-yl]methylideneamino]pyridine-3-carboxamide | 2 - N-[(Z)-[1-[(3-fluorophenyl)methyl]indol-5-yl]methylideneamino]pyridine-3-carboxamide