| MolName | 1-[(Z)-[(Z)-2-bromo-3-phenylprop-2-enylidene]amino]-3-cyclohexylurea |
| MolecularFormula | C16H20N3OBr |
| Smiles | O=C(NC1CCCCC1)N/N=C\C(\Br)=C\c1ccccc1 |
| InChI | InChI=1S/C16H20BrN3O/c17-14(11-13-7-3-1-4-8-13)12-18-20-16(21)19-15-9-5-2-6-10-15/h1,3-4,7-8,11-12,15H,2,5-6,9-10H2,(H2,19,20,21) |
| InChIK | XKHDFIMXKSAKST-UHFFFAOYSA-N |
| TotalMolweight | 350.259 |
| Molweight | 350.259 |
| MonoisotopicMass | 349.078973 |
| CLogP | 3.6534 |
| CLogS | -5.429 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 249.83 |
| Relative PSA | 0.19001 |
| PolarSurfaceArea | 53.49 |
| Druglikeness | -5.0898 |
| Mutagenic | high |
| Tumorigenic | low |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 6 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-[(Z)-[(Z)-2-bromo-3-phenylprop-2-enylidene]amino]-3-cyclohexylurea | 2 - 1-[(Z)-[(Z)-2-bromo-3-phenylprop-2-enylidene]amino]-3-cyclohexylurea