| MolName | N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-4-[(4-phenyl-1,3-thiazol-2-yl)amino]benzamide |
| MolecularFormula | C24H17N4O3BrS |
| Smiles | O=C(c(cc1)ccc1Nc1nc(-c2ccccc2)cs1)N/N=C\c(cc1OCOc1c1)c1Br |
| InChI | InChI=1S/C24H17BrN4O3S/c25-19-11-22-21(31-14-32-22)10-17(19)12-26-29-23(30)16-6-8-18(9-7-16)27-24-28-20(13-33-24)15-4-2-1-3-5-15/h1-13H,14H2,(H,27,28)(H,29,30) |
| InChIK | XLOFARNHYSKLDF-UHFFFAOYSA-N |
| TotalMolweight | 521.394 |
| Molweight | 521.394 |
| MonoisotopicMass | 520.020472 |
| CLogP | 6.9441 |
| CLogS | -8.355 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 351.56 |
| Relative PSA | 0.28103 |
| PolarSurfaceArea | 113.08 |
| Druglikeness | 3.8735 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | limit! thiazol-2-ylamine; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-4-[(4-phenyl-1,3-thiazol-2-yl)amino]benzamide | 2 - N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-4-[(4-phenyl-1,3-thiazol-2-yl)amino]benzamide