| MolName | N-[(Z)-(2-nitrophenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
| MolecularFormula | C16H12N4O2S |
| Smiles | [O-][N+](c1c(/C=N\Nc2nc(-c3ccccc3)cs2)cccc1)=O |
| InChI | InChI=1S/C16H12N4O2S/c21-20(22)15-9-5-4-8-13(15)10-17-19-16-18-14(11-23-16)12-6-2-1-3-7-12/h1-11H,(H,18,19) |
| InChIK | XLSNLUZCDRMZLK-UHFFFAOYSA-N |
| TotalMolweight | 324.363 |
| Molweight | 324.363 |
| MonoisotopicMass | 324.068096 |
| CLogP | 5.1244 |
| CLogS | -5.12 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 247.37 |
| Relative PSA | 0.34248 |
| PolarSurfaceArea | 111.34 |
| Druglikeness | -1.2848 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.6087 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-nitrophenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-amine | 2 - N-[(Z)-(2-nitrophenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-amine