| MolName | 4-[5-[(Z)-(phenylhydrazinylidene)methyl]furan-2-yl]benzenesulfonamide |
| MolecularFormula | C17H15N3O3S |
| Smiles | NS(c(cc1)ccc1-c1ccc(/C=N\Nc2ccccc2)o1)(=O)=O |
| InChI | InChI=1S/C17H15N3O3S/c18-24(21,22)16-9-6-13(7-10-16)17-11-8-15(23-17)12-19-20-14-4-2-1-3-5-14/h1-12,20H,(H2,18,21,22) |
| InChIK | XLVZDMMVWPKMFU-UHFFFAOYSA-N |
| TotalMolweight | 341.39 |
| Molweight | 341.39 |
| MonoisotopicMass | 341.083412 |
| CLogP | 4.5438 |
| CLogS | -4.508 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 255.79 |
| Relative PSA | 0.31639 |
| PolarSurfaceArea | 106.07 |
| Druglikeness | 4.6654 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Symmetricatoms | 5 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[5-[(Z)-(phenylhydrazinylidene)methyl]furan-2-yl]benzenesulfonamide | 2 - 4-[5-[(Z)-(phenylhydrazinylidene)methyl]furan-2-yl]benzenesulfonamide