| MolName | 5-[5-[(E)-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)iminomethyl]furan-2-yl]benzene-1,3-dicarboxylic acid |
| MolecularFormula | C23H17N3O6S |
| Smiles | OC(c1cc(-c2ccc(/C=N/N(C=Nc3c4c(CCCC5)c5s3)C4=O)o2)cc(C(O)=O)c1)=O |
| InChI | InChI=1S/C23H17N3O6S/c27-21-19-16-3-1-2-4-18(16)33-20(19)24-11-26(21)25-10-15-5-6-17(32-15)12-7-13(22(28)29)9-14(8-12)23(30)31/h5-11H,1-4H2,(H,28,29)(H,30,31) |
| InChIK | XMYSUALEDCBBJC-UHFFFAOYSA-N |
| TotalMolweight | 463.469 |
| Molweight | 463.469 |
| MonoisotopicMass | 463.083807 |
| CLogP | 3.5941 |
| CLogS | -6.537 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 332.22 |
| Relative PSA | 0.38035 |
| PolarSurfaceArea | 161.01 |
| Druglikeness | 3.2461 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51515 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 6 |
| Symmetricatoms | 5 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 5-[5-[(E)-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)iminomethyl]furan-2-yl]benzene-1,3-dicarboxylic acid | 2 - 5-[5-[(E)-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)iminomethyl]furan-2-yl]benzene-1,3-dicarboxylic acid