| MolName | (Z)-3-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-(3-chlorophenyl)-N-(2-morpholin-4-ylethyl)-1,3-thiazol-2-imine |
| MolecularFormula | C23H23N4O3ClS |
| Smiles | Clc1cc(C(N2/N=C\c(cc3)cc4c3OCO4)=CS/C2=N\CCN2CCOCC2)ccc1 |
| InChI | InChI=1S/C23H23ClN4O3S/c24-19-3-1-2-18(13-19)20-15-32-23(25-6-7-27-8-10-29-11-9-27)28(20)26-14-17-4-5-21-22(12-17)31-16-30-21/h1-5,12-15H,6-11,16H2 |
| InChIK | XNDBSNLTTKYDFC-UHFFFAOYSA-N |
| TotalMolweight | 470.98 |
| Molweight | 470.98 |
| MonoisotopicMass | 470.117938 |
| CLogP | 4.4362 |
| CLogS | -5.409 |
| H Acceptors | 7 |
| TotalSurfaceArea | 344.79 |
| Relative PSA | 0.22509 |
| PolarSurfaceArea | 84.19 |
| Druglikeness | 5.7864 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 12 |
| Symmetricatoms | 2 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-3-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-(3-chlorophenyl)-N-(2-morpholin-4-ylethyl)-1,3-thiazol-2-imine | 2 - (Z)-3-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-(3-chlorophenyl)-N-(2-morpholin-4-ylethyl)-1,3-thiazol-2-imine