| MolName | [(Z)-(2-morpholin-4-yl-1,3-thiazol-5-yl)methylideneamino]thiourea |
| MolecularFormula | C9H13N5OS2 |
| Smiles | NC(N/N=C\c1cnc(N2CCOCC2)s1)=S |
| InChI | InChI=1S/C9H13N5OS2/c10-8(16)13-12-6-7-5-11-9(17-7)14-1-3-15-4-2-14/h5-6H,1-4H2,(H3,10,13,16) |
| InChIK | XNDXFZTYUSCPIK-UHFFFAOYSA-N |
| TotalMolweight | 271.368 |
| Molweight | 271.368 |
| MonoisotopicMass | 271.05615 |
| CLogP | 0.9085 |
| CLogS | -2.844 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 207.25 |
| Relative PSA | 0.53616 |
| PolarSurfaceArea | 136.1 |
| Druglikeness | 4.3757 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.70588 |
| Fragments | 1 |
| Non HAtoms | 17 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 5 |
| Sp3Atoms | 6 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [(Z)-(2-morpholin-4-yl-1,3-thiazol-5-yl)methylideneamino]thiourea | 2 - [(Z)-(2-morpholin-4-yl-1,3-thiazol-5-yl)methylideneamino]thiourea