| MolName | 4-[(Z)-[2-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-3-phenyl-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C22H17N4OClS |
| Smiles | S=C(NN=C1c2ccccc2)N1/N=C\c(cccc1)c1OCc(cc1)ccc1Cl |
| InChI | InChI=1S/C22H17ClN4OS/c23-19-12-10-16(11-13-19)15-28-20-9-5-4-8-18(20)14-24-27-21(25-26-22(27)29)17-6-2-1-3-7-17/h1-14H,15H2,(H,26,29) |
| InChIK | XNGHKHJXDVWXON-UHFFFAOYSA-N |
| TotalMolweight | 420.923 |
| Molweight | 420.923 |
| MonoisotopicMass | 420.081158 |
| CLogP | 5.2491 |
| CLogS | -6.528 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 320.66 |
| Relative PSA | 0.2371 |
| PolarSurfaceArea | 81.31 |
| Druglikeness | 3.229 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.58621 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[2-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-3-phenyl-1H-1,2,4-triazole-5-thione | 2 - 4-[(Z)-[2-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-3-phenyl-1H-1,2,4-triazole-5-thione