| MolName | N-[(E)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-[5-(phenylcarbamoylamino)-1,3,4-thiadiazol-2-yl]acetamide |
| MolecularFormula | C19H15N6O4BrS |
| Smiles | O=C(Cc1nnc(NC(Nc2ccccc2)=O)s1)N/N=C/c(cc1OCOc1c1)c1Br |
| InChI | InChI=1S/C19H15BrN6O4S/c20-13-7-15-14(29-10-30-15)6-11(13)9-21-24-16(27)8-17-25-26-19(31-17)23-18(28)22-12-4-2-1-3-5-12/h1-7,9H,8,10H2,(H,24,27)(H2,22,23,26,28) |
| InChIK | XNIHXSDNPKGMHT-UHFFFAOYSA-N |
| TotalMolweight | 503.336 |
| Molweight | 503.336 |
| MonoisotopicMass | 502.005885 |
| CLogP | 4.0207 |
| CLogS | -6.466 |
| H Acceptors | 10 |
| H Donors | 3 |
| TotalSurfaceArea | 333.53 |
| Relative PSA | 0.40257 |
| PolarSurfaceArea | 155.07 |
| Druglikeness | 4.5828 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64516 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Amides | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(E)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-[5-(phenylcarbamoylamino)-1,3,4-thiadiazol-2-yl]acetamide | 2 - N-[(E)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-[5-(phenylcarbamoylamino)-1,3,4-thiadiazol-2-yl]acetamide